C25H28N4O4 — CID 95098497
(3R)-1-(1-acetyl-2,3-dihydroindol-5-yl)-N-(4-morpholin-4-ylphenyl)-5-oxopyrrolidine-3-carboxamide (PubChem CID 95098497) has the molecular formula C25H28N4O4 and a molecular weight of 448.52 g/mol. Its IUPAC name is (3R)-1-(1-acetyl-2,3-dihydroindol-5-yl)-N-(4-morpholin-4-ylphenyl)-5-oxopyrrolidine-3-carboxamide.
| Compound Name | (3R)-1-(1-acetyl-2,3-dihydroindol-5-yl)-N-(4-morpholin-4-ylphenyl)-5-oxopyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 95098497 |
| Molecular Formula | C25H28N4O4 |
| Molecular Weight | 448.52 g/mol |
| Exact Mass | 448.21 |
| IUPAC Name | (3R)-1-(1-acetyl-2,3-dihydroindol-5-yl)-N-(4-morpholin-4-ylphenyl)-5-oxopyrrolidine-3-carboxamide |
| SMILES | CC(=O)N1CCc2cc(N3C[C@H](C(=O)Nc4ccc(N5CCOCC5)cc4)CC3=O)ccc21 |
| InChI | InChI=1S/C25H28N4O4/c1-17(30)28-9-8-18-14-22(6-7-23(18)28)29-16-19(15-24(29)31)25(32)26-20-2-4-21(5-3-20)27-10-12-33-13-11-27/h2-7,14,19H,8-13,15-16H2,1H3,(H,26,32)/t19-/m1/s1 |
| InChIKey | NPLSRIRWHILTLU-LJQANCHMSA-N |
| XLogP | 2.42 |
| TPSA | 82.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.52 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|