C15H17N3O2S — CID 95099186
2-N-ethyl-4-N-[(1R)-1-phenylethyl]-1,3-thiazole-2,4-dicarboxamide (PubChem CID 95099186) has the molecular formula C15H17N3O2S and a molecular weight of 303.39 g/mol. Its IUPAC name is 2-N-ethyl-4-N-[(1R)-1-phenylethyl]-1,3-thiazole-2,4-dicarboxamide.
| Compound Name | 2-N-ethyl-4-N-[(1R)-1-phenylethyl]-1,3-thiazole-2,4-dicarboxamide |
|---|---|
| PubChem CID | 95099186 |
| Molecular Formula | C15H17N3O2S |
| Molecular Weight | 303.39 g/mol |
| Exact Mass | 303.10 |
| IUPAC Name | 2-N-ethyl-4-N-[(1R)-1-phenylethyl]-1,3-thiazole-2,4-dicarboxamide |
| SMILES | CCNC(=O)c1nc(C(=O)N[C@H](C)c2ccccc2)cs1 |
| InChI | InChI=1S/C15H17N3O2S/c1-3-16-14(20)15-18-12(9-21-15)13(19)17-10(2)11-7-5-4-6-8-11/h4-10H,3H2,1-2H3,(H,16,20)(H,17,19)/t10-/m1/s1 |
| InChIKey | RNMTYHBHRDVFQV-SNVBAGLBSA-N |
| XLogP | 2.38 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.39 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |