C17H17N3O4 — CID 95102379
(2R)-N-(4-ethoxyphenyl)-2-methyl-3-oxo-4H-pyrido[3,2-b][1,4]oxazine-2-carboxamide (PubChem CID 95102379) has the molecular formula C17H17N3O4 and a molecular weight of 327.34 g/mol. Its IUPAC name is (2R)-N-(4-ethoxyphenyl)-2-methyl-3-oxo-4H-pyrido[3,2-b][1,4]oxazine-2-carboxamide.
| Compound Name | (2R)-N-(4-ethoxyphenyl)-2-methyl-3-oxo-4H-pyrido[3,2-b][1,4]oxazine-2-carboxamide |
|---|---|
| PubChem CID | 95102379 |
| Molecular Formula | C17H17N3O4 |
| Molecular Weight | 327.34 g/mol |
| Exact Mass | 327.12 |
| IUPAC Name | (2R)-N-(4-ethoxyphenyl)-2-methyl-3-oxo-4H-pyrido[3,2-b][1,4]oxazine-2-carboxamide |
| SMILES | CCOc1ccc(NC(=O)[C@@]2(C)Oc3cccnc3NC2=O)cc1 |
| InChI | InChI=1S/C17H17N3O4/c1-3-23-12-8-6-11(7-9-12)19-15(21)17(2)16(22)20-14-13(24-17)5-4-10-18-14/h4-10H,3H2,1-2H3,(H,19,21)(H,18,20,22)/t17-/m1/s1 |
| InChIKey | MPTFSFILIKCGLZ-QGZVFWFLSA-N |
| XLogP | 2.21 |
| TPSA | 89.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.34 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|