C18H25N3O3 — CID 95102732
(2R)-4-butyl-N-cyclopentyl-2-methyl-3-oxopyrido[3,2-b][1,4]oxazine-2-carboxamide (PubChem CID 95102732) has the molecular formula C18H25N3O3 and a molecular weight of 331.42 g/mol. Its IUPAC name is (2R)-4-butyl-N-cyclopentyl-2-methyl-3-oxopyrido[3,2-b][1,4]oxazine-2-carboxamide.
| Compound Name | (2R)-4-butyl-N-cyclopentyl-2-methyl-3-oxopyrido[3,2-b][1,4]oxazine-2-carboxamide |
|---|---|
| PubChem CID | 95102732 |
| Molecular Formula | C18H25N3O3 |
| Molecular Weight | 331.42 g/mol |
| Exact Mass | 331.19 |
| IUPAC Name | (2R)-4-butyl-N-cyclopentyl-2-methyl-3-oxopyrido[3,2-b][1,4]oxazine-2-carboxamide |
| SMILES | CCCCN1C(=O)[C@@](C)(C(=O)NC2CCCC2)Oc2cccnc21 |
| InChI | InChI=1S/C18H25N3O3/c1-3-4-12-21-15-14(10-7-11-19-15)24-18(2,17(21)23)16(22)20-13-8-5-6-9-13/h7,10-11,13H,3-6,8-9,12H2,1-2H3,(H,20,22)/t18-/m1/s1 |
| InChIKey | HUCYKWDKOGOEFM-GOSISDBHSA-N |
| XLogP | 2.42 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.42 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|