C19H20ClN3O3 — CID 95102702
(2R)-4-butyl-N-(3-chlorophenyl)-2-methyl-3-oxopyrido[3,2-b][1,4]oxazine-2-carboxamide (PubChem CID 95102702) has the molecular formula C19H20ClN3O3 and a molecular weight of 373.84 g/mol. Its IUPAC name is (2R)-4-butyl-N-(3-chlorophenyl)-2-methyl-3-oxopyrido[3,2-b][1,4]oxazine-2-carboxamide.
| Compound Name | (2R)-4-butyl-N-(3-chlorophenyl)-2-methyl-3-oxopyrido[3,2-b][1,4]oxazine-2-carboxamide |
|---|---|
| PubChem CID | 95102702 |
| Molecular Formula | C19H20ClN3O3 |
| Molecular Weight | 373.84 g/mol |
| Exact Mass | 373.12 |
| IUPAC Name | (2R)-4-butyl-N-(3-chlorophenyl)-2-methyl-3-oxopyrido[3,2-b][1,4]oxazine-2-carboxamide |
| SMILES | CCCCN1C(=O)[C@@](C)(C(=O)Nc2cccc(Cl)c2)Oc2cccnc21 |
| InChI | InChI=1S/C19H20ClN3O3/c1-3-4-11-23-16-15(9-6-10-21-16)26-19(2,18(23)25)17(24)22-14-8-5-7-13(20)12-14/h5-10,12H,3-4,11H2,1-2H3,(H,22,24)/t19-/m1/s1 |
| InChIKey | LZXASQUSZAYONG-LJQANCHMSA-N |
| XLogP | 3.66 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.84 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|