C24H26N4O3 — CID 95105106
N-(3,4-dimethoxyphenyl)-6-[(3R)-3-phenylpiperazin-1-yl]pyridine-3-carboxamide (PubChem CID 95105106) has the molecular formula C24H26N4O3 and a molecular weight of 418.50 g/mol. Its IUPAC name is N-(3,4-dimethoxyphenyl)-6-[(3R)-3-phenylpiperazin-1-yl]pyridine-3-carboxamide.
| Compound Name | N-(3,4-dimethoxyphenyl)-6-[(3R)-3-phenylpiperazin-1-yl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 95105106 |
| Molecular Formula | C24H26N4O3 |
| Molecular Weight | 418.50 g/mol |
| Exact Mass | 418.20 |
| IUPAC Name | N-(3,4-dimethoxyphenyl)-6-[(3R)-3-phenylpiperazin-1-yl]pyridine-3-carboxamide |
| SMILES | COc1ccc(NC(=O)c2ccc(N3CCN[C@H](c4ccccc4)C3)nc2)cc1OC |
| InChI | InChI=1S/C24H26N4O3/c1-30-21-10-9-19(14-22(21)31-2)27-24(29)18-8-11-23(26-15-18)28-13-12-25-20(16-28)17-6-4-3-5-7-17/h3-11,14-15,20,25H,12-13,16H2,1-2H3,(H,27,29)/t20-/m0/s1 |
| InChIKey | NIQUEUYBZRQVQR-FQEVSTJZSA-N |
| XLogP | 3.50 |
| TPSA | 75.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.50 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |