C25H35N5O — CID 95105402
N-[3-(4-methylpiperidin-1-yl)propyl]-6-[(3R)-3-phenylpiperazin-1-yl]pyridine-3-carboxamide (PubChem CID 95105402) has the molecular formula C25H35N5O and a molecular weight of 421.59 g/mol. Its IUPAC name is N-[3-(4-methylpiperidin-1-yl)propyl]-6-[(3R)-3-phenylpiperazin-1-yl]pyridine-3-carboxamide.
| Compound Name | N-[3-(4-methylpiperidin-1-yl)propyl]-6-[(3R)-3-phenylpiperazin-1-yl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 95105402 |
| Molecular Formula | C25H35N5O |
| Molecular Weight | 421.59 g/mol |
| Exact Mass | 421.28 |
| IUPAC Name | N-[3-(4-methylpiperidin-1-yl)propyl]-6-[(3R)-3-phenylpiperazin-1-yl]pyridine-3-carboxamide |
| SMILES | CC1CCN(CCCNC(=O)c2ccc(N3CCN[C@H](c4ccccc4)C3)nc2)CC1 |
| InChI | InChI=1S/C25H35N5O/c1-20-10-15-29(16-11-20)14-5-12-27-25(31)22-8-9-24(28-18-22)30-17-13-26-23(19-30)21-6-3-2-4-7-21/h2-4,6-9,18,20,23,26H,5,10-17,19H2,1H3,(H,27,31)/t23-/m0/s1 |
| InChIKey | SWDPSGHHDIHFAU-QHCPKHFHSA-N |
| XLogP | 3.08 |
| TPSA | 60.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.59 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|