C23H31N5O2 — CID 95104938
N-(3-morpholin-4-ylpropyl)-2-[(3S)-3-phenylpiperazin-1-yl]pyridine-4-carboxamide (PubChem CID 95104938) has the molecular formula C23H31N5O2 and a molecular weight of 409.53 g/mol. Its IUPAC name is N-(3-morpholin-4-ylpropyl)-2-[(3S)-3-phenylpiperazin-1-yl]pyridine-4-carboxamide.
| Compound Name | N-(3-morpholin-4-ylpropyl)-2-[(3S)-3-phenylpiperazin-1-yl]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 95104938 |
| Molecular Formula | C23H31N5O2 |
| Molecular Weight | 409.53 g/mol |
| Exact Mass | 409.25 |
| IUPAC Name | N-(3-morpholin-4-ylpropyl)-2-[(3S)-3-phenylpiperazin-1-yl]pyridine-4-carboxamide |
| SMILES | O=C(NCCCN1CCOCC1)c1ccnc(N2CCN[C@@H](c3ccccc3)C2)c1 |
| InChI | InChI=1S/C23H31N5O2/c29-23(26-8-4-11-27-13-15-30-16-14-27)20-7-9-25-22(17-20)28-12-10-24-21(18-28)19-5-2-1-3-6-19/h1-3,5-7,9,17,21,24H,4,8,10-16,18H2,(H,26,29)/t21-/m1/s1 |
| InChIKey | VLILMBNFPWCJQY-OAQYLSRUSA-N |
| XLogP | 1.68 |
| TPSA | 69.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.53 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|