C20H26N4O — CID 95105030
N,N-diethyl-2-[(3S)-3-phenylpiperazin-1-yl]pyridine-4-carboxamide (PubChem CID 95105030) has the molecular formula C20H26N4O and a molecular weight of 338.46 g/mol. Its IUPAC name is N,N-diethyl-2-[(3S)-3-phenylpiperazin-1-yl]pyridine-4-carboxamide.
| Compound Name | N,N-diethyl-2-[(3S)-3-phenylpiperazin-1-yl]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 95105030 |
| Molecular Formula | C20H26N4O |
| Molecular Weight | 338.46 g/mol |
| Exact Mass | 338.21 |
| IUPAC Name | N,N-diethyl-2-[(3S)-3-phenylpiperazin-1-yl]pyridine-4-carboxamide |
| SMILES | CCN(CC)C(=O)c1ccnc(N2CCN[C@@H](c3ccccc3)C2)c1 |
| InChI | InChI=1S/C20H26N4O/c1-3-23(4-2)20(25)17-10-11-22-19(14-17)24-13-12-21-18(15-24)16-8-6-5-7-9-16/h5-11,14,18,21H,3-4,12-13,15H2,1-2H3/t18-/m1/s1 |
| InChIKey | MVQSSLUIGFVUTJ-GOSISDBHSA-N |
| XLogP | 2.71 |
| TPSA | 48.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.46 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |