C24H26N4O — CID 95104988
N-benzyl-N-methyl-2-[(3S)-3-phenylpiperazin-1-yl]pyridine-4-carboxamide (PubChem CID 95104988) has the molecular formula C24H26N4O and a molecular weight of 386.50 g/mol. Its IUPAC name is N-benzyl-N-methyl-2-[(3S)-3-phenylpiperazin-1-yl]pyridine-4-carboxamide.
| Compound Name | N-benzyl-N-methyl-2-[(3S)-3-phenylpiperazin-1-yl]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 95104988 |
| Molecular Formula | C24H26N4O |
| Molecular Weight | 386.50 g/mol |
| Exact Mass | 386.21 |
| IUPAC Name | N-benzyl-N-methyl-2-[(3S)-3-phenylpiperazin-1-yl]pyridine-4-carboxamide |
| SMILES | CN(Cc1ccccc1)C(=O)c1ccnc(N2CCN[C@@H](c3ccccc3)C2)c1 |
| InChI | InChI=1S/C24H26N4O/c1-27(17-19-8-4-2-5-9-19)24(29)21-12-13-26-23(16-21)28-15-14-25-22(18-28)20-10-6-3-7-11-20/h2-13,16,22,25H,14-15,17-18H2,1H3/t22-/m1/s1 |
| InChIKey | RDBWISZLRDRUAZ-JOCHJYFZSA-N |
| XLogP | 3.50 |
| TPSA | 48.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.50 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |