C20H24N4OS — CID 95104986
[2-[(3S)-3-phenylpiperazin-1-yl]-4-pyridinyl]-thiomorpholin-4-ylmethanone (PubChem CID 95104986) has the molecular formula C20H24N4OS and a molecular weight of 368.51 g/mol. Its IUPAC name is [2-[(3S)-3-phenylpiperazin-1-yl]-4-pyridinyl]-thiomorpholin-4-ylmethanone.
| Compound Name | [2-[(3S)-3-phenylpiperazin-1-yl]-4-pyridinyl]-thiomorpholin-4-ylmethanone |
|---|---|
| PubChem CID | 95104986 |
| Molecular Formula | C20H24N4OS |
| Molecular Weight | 368.51 g/mol |
| Exact Mass | 368.17 |
| IUPAC Name | [2-[(3S)-3-phenylpiperazin-1-yl]-4-pyridinyl]-thiomorpholin-4-ylmethanone |
| SMILES | O=C(c1ccnc(N2CCN[C@@H](c3ccccc3)C2)c1)N1CCSCC1 |
| InChI | InChI=1S/C20H24N4OS/c25-20(23-10-12-26-13-11-23)17-6-7-22-19(14-17)24-9-8-21-18(15-24)16-4-2-1-3-5-16/h1-7,14,18,21H,8-13,15H2/t18-/m1/s1 |
| InChIKey | NDFPBUPEUQSDGD-GOSISDBHSA-N |
| XLogP | 2.42 |
| TPSA | 48.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.51 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |