C23H23ClN4O — CID 95105024
N-[(2-chlorophenyl)methyl]-2-[(3S)-3-phenylpiperazin-1-yl]pyridine-4-carboxamide (PubChem CID 95105024) has the molecular formula C23H23ClN4O and a molecular weight of 406.92 g/mol. Its IUPAC name is N-[(2-chlorophenyl)methyl]-2-[(3S)-3-phenylpiperazin-1-yl]pyridine-4-carboxamide.
| Compound Name | N-[(2-chlorophenyl)methyl]-2-[(3S)-3-phenylpiperazin-1-yl]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 95105024 |
| Molecular Formula | C23H23ClN4O |
| Molecular Weight | 406.92 g/mol |
| Exact Mass | 406.16 |
| IUPAC Name | N-[(2-chlorophenyl)methyl]-2-[(3S)-3-phenylpiperazin-1-yl]pyridine-4-carboxamide |
| SMILES | O=C(NCc1ccccc1Cl)c1ccnc(N2CCN[C@@H](c3ccccc3)C2)c1 |
| InChI | InChI=1S/C23H23ClN4O/c24-20-9-5-4-8-19(20)15-27-23(29)18-10-11-26-22(14-18)28-13-12-25-21(16-28)17-6-2-1-3-7-17/h1-11,14,21,25H,12-13,15-16H2,(H,27,29)/t21-/m1/s1 |
| InChIKey | ANFSBJOZFKUWPJ-OAQYLSRUSA-N |
| XLogP | 3.82 |
| TPSA | 57.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.92 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |