C24H26N4O2 — CID 95105307
N-(4-ethoxyphenyl)-6-[(3R)-3-phenylpiperazin-1-yl]pyridine-2-carboxamide (PubChem CID 95105307) has the molecular formula C24H26N4O2 and a molecular weight of 402.50 g/mol. Its IUPAC name is N-(4-ethoxyphenyl)-6-[(3R)-3-phenylpiperazin-1-yl]pyridine-2-carboxamide.
| Compound Name | N-(4-ethoxyphenyl)-6-[(3R)-3-phenylpiperazin-1-yl]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 95105307 |
| Molecular Formula | C24H26N4O2 |
| Molecular Weight | 402.50 g/mol |
| Exact Mass | 402.21 |
| IUPAC Name | N-(4-ethoxyphenyl)-6-[(3R)-3-phenylpiperazin-1-yl]pyridine-2-carboxamide |
| SMILES | CCOc1ccc(NC(=O)c2cccc(N3CCN[C@H](c4ccccc4)C3)n2)cc1 |
| InChI | InChI=1S/C24H26N4O2/c1-2-30-20-13-11-19(12-14-20)26-24(29)21-9-6-10-23(27-21)28-16-15-25-22(17-28)18-7-4-3-5-8-18/h3-14,22,25H,2,15-17H2,1H3,(H,26,29)/t22-/m0/s1 |
| InChIKey | GJLWQYPXQJJLOD-QFIPXVFZSA-N |
| XLogP | 3.88 |
| TPSA | 66.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.50 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |