C21H26N4O3 — CID 95105589
N-cyclopropyl-6-[(3R)-3-[(2-hydroxy-5-methoxyphenyl)methylamino]pyrrolidin-1-yl]pyridine-3-carboxamide (PubChem CID 95105589) has the molecular formula C21H26N4O3 and a molecular weight of 382.46 g/mol. Its IUPAC name is N-cyclopropyl-6-[(3R)-3-[(2-hydroxy-5-methoxyphenyl)methylamino]pyrrolidin-1-yl]pyridine-3-carboxamide.
| Compound Name | N-cyclopropyl-6-[(3R)-3-[(2-hydroxy-5-methoxyphenyl)methylamino]pyrrolidin-1-yl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 95105589 |
| Molecular Formula | C21H26N4O3 |
| Molecular Weight | 382.46 g/mol |
| Exact Mass | 382.20 |
| IUPAC Name | N-cyclopropyl-6-[(3R)-3-[(2-hydroxy-5-methoxyphenyl)methylamino]pyrrolidin-1-yl]pyridine-3-carboxamide |
| SMILES | COc1ccc(O)c(CN[C@@H]2CCN(c3ccc(C(=O)NC4CC4)cn3)C2)c1 |
| InChI | InChI=1S/C21H26N4O3/c1-28-18-5-6-19(26)15(10-18)12-22-17-8-9-25(13-17)20-7-2-14(11-23-20)21(27)24-16-3-4-16/h2,5-7,10-11,16-17,22,26H,3-4,8-9,12-13H2,1H3,(H,24,27)/t17-/m1/s1 |
| InChIKey | OBCQKCYDWGDYFD-QGZVFWFLSA-N |
| XLogP | 2.06 |
| TPSA | 86.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.46 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|