C23H23FN4O2 — CID 95105620
N-(3-fluorophenyl)-6-[(3S)-3-[(2-hydroxyphenyl)methylamino]pyrrolidin-1-yl]pyridine-3-carboxamide (PubChem CID 95105620) has the molecular formula C23H23FN4O2 and a molecular weight of 406.46 g/mol. Its IUPAC name is N-(3-fluorophenyl)-6-[(3S)-3-[(2-hydroxyphenyl)methylamino]pyrrolidin-1-yl]pyridine-3-carboxamide.
| Compound Name | N-(3-fluorophenyl)-6-[(3S)-3-[(2-hydroxyphenyl)methylamino]pyrrolidin-1-yl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 95105620 |
| Molecular Formula | C23H23FN4O2 |
| Molecular Weight | 406.46 g/mol |
| Exact Mass | 406.18 |
| IUPAC Name | N-(3-fluorophenyl)-6-[(3S)-3-[(2-hydroxyphenyl)methylamino]pyrrolidin-1-yl]pyridine-3-carboxamide |
| SMILES | O=C(Nc1cccc(F)c1)c1ccc(N2CC[C@H](NCc3ccccc3O)C2)nc1 |
| InChI | InChI=1S/C23H23FN4O2/c24-18-5-3-6-19(12-18)27-23(30)17-8-9-22(26-14-17)28-11-10-20(15-28)25-13-16-4-1-2-7-21(16)29/h1-9,12,14,20,25,29H,10-11,13,15H2,(H,27,30)/t20-/m0/s1 |
| InChIKey | TUGGIULIOBADBN-FQEVSTJZSA-N |
| XLogP | 3.55 |
| TPSA | 77.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.46 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|