C17H22F3N5O2 — CID 95114708
(3R)-N-(3-methoxypropyl)-1-[6-(trifluoromethyl)-[1,2,4]triazolo[4,3-a]pyridin-3-yl]piperidine-3-carboxamide (PubChem CID 95114708) has the molecular formula C17H22F3N5O2 and a molecular weight of 385.39 g/mol. Its IUPAC name is (3R)-N-(3-methoxypropyl)-1-[6-(trifluoromethyl)-[1,2,4]triazolo[4,3-a]pyridin-3-yl]piperidine-3-carboxamide.
| Compound Name | (3R)-N-(3-methoxypropyl)-1-[6-(trifluoromethyl)-[1,2,4]triazolo[4,3-a]pyridin-3-yl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 95114708 |
| Molecular Formula | C17H22F3N5O2 |
| Molecular Weight | 385.39 g/mol |
| Exact Mass | 385.17 |
| IUPAC Name | (3R)-N-(3-methoxypropyl)-1-[6-(trifluoromethyl)-[1,2,4]triazolo[4,3-a]pyridin-3-yl]piperidine-3-carboxamide |
| SMILES | COCCCNC(=O)[C@@H]1CCCN(c2nnc3ccc(C(F)(F)F)cn23)C1 |
| InChI | InChI=1S/C17H22F3N5O2/c1-27-9-3-7-21-15(26)12-4-2-8-24(10-12)16-23-22-14-6-5-13(11-25(14)16)17(18,19)20/h5-6,11-12H,2-4,7-10H2,1H3,(H,21,26)/t12-/m1/s1 |
| InChIKey | HTFWCAHEWQOZHD-GFCCVEGCSA-N |
| XLogP | 2.12 |
| TPSA | 71.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.39 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|