C16H22ClN5O — CID 53203332
N-butyl-1-(6-chloro-[1,2,4]triazolo[4,3-a]pyridin-3-yl)piperidine-3-carboxamide (PubChem CID 53203332) has the molecular formula C16H22ClN5O and a molecular weight of 335.84 g/mol. Its IUPAC name is N-butyl-1-(6-chloro-[1,2,4]triazolo[4,3-a]pyridin-3-yl)piperidine-3-carboxamide.
| Compound Name | N-butyl-1-(6-chloro-[1,2,4]triazolo[4,3-a]pyridin-3-yl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 53203332 |
| Molecular Formula | C16H22ClN5O |
| Molecular Weight | 335.84 g/mol |
| Exact Mass | 335.15 |
| IUPAC Name | N-butyl-1-(6-chloro-[1,2,4]triazolo[4,3-a]pyridin-3-yl)piperidine-3-carboxamide |
| SMILES | CCCCNC(=O)C1CCCN(c2nnc3ccc(Cl)cn23)C1 |
| InChI | InChI=1S/C16H22ClN5O/c1-2-3-8-18-15(23)12-5-4-9-21(10-12)16-20-19-14-7-6-13(17)11-22(14)16/h6-7,11-12H,2-5,8-10H2,1H3,(H,18,23) |
| InChIKey | JRCGXWXTZGJXPS-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 62.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.84 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|