C18H22N4O3 — CID 95115313
(3S)-N-(2-methoxy-5-methylphenyl)-1-(6-oxo-1H-pyridazin-4-yl)piperidine-3-carboxamide (PubChem CID 95115313) has the molecular formula C18H22N4O3 and a molecular weight of 342.40 g/mol. Its IUPAC name is (3S)-N-(2-methoxy-5-methylphenyl)-1-(6-oxo-1H-pyridazin-4-yl)piperidine-3-carboxamide.
| Compound Name | (3S)-N-(2-methoxy-5-methylphenyl)-1-(6-oxo-1H-pyridazin-4-yl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 95115313 |
| Molecular Formula | C18H22N4O3 |
| Molecular Weight | 342.40 g/mol |
| Exact Mass | 342.17 |
| IUPAC Name | (3S)-N-(2-methoxy-5-methylphenyl)-1-(6-oxo-1H-pyridazin-4-yl)piperidine-3-carboxamide |
| SMILES | COc1ccc(C)cc1NC(=O)[C@H]1CCCN(c2cn[nH]c(=O)c2)C1 |
| InChI | InChI=1S/C18H22N4O3/c1-12-5-6-16(25-2)15(8-12)20-18(24)13-4-3-7-22(11-13)14-9-17(23)21-19-10-14/h5-6,8-10,13H,3-4,7,11H2,1-2H3,(H,20,24)(H,21,23)/t13-/m0/s1 |
| InChIKey | YXLZSYNWSHEDPW-ZDUSSCGKSA-N |
| XLogP | 1.94 |
| TPSA | 87.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.40 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |