C18H22N4O3 — CID 95115508
(3S)-N-(2-methoxyphenyl)-1-(1-methyl-6-oxopyridazin-4-yl)piperidine-3-carboxamide (PubChem CID 95115508) has the molecular formula C18H22N4O3 and a molecular weight of 342.40 g/mol. Its IUPAC name is (3S)-N-(2-methoxyphenyl)-1-(1-methyl-6-oxopyridazin-4-yl)piperidine-3-carboxamide.
| Compound Name | (3S)-N-(2-methoxyphenyl)-1-(1-methyl-6-oxopyridazin-4-yl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 95115508 |
| Molecular Formula | C18H22N4O3 |
| Molecular Weight | 342.40 g/mol |
| Exact Mass | 342.17 |
| IUPAC Name | (3S)-N-(2-methoxyphenyl)-1-(1-methyl-6-oxopyridazin-4-yl)piperidine-3-carboxamide |
| SMILES | COc1ccccc1NC(=O)[C@H]1CCCN(c2cnn(C)c(=O)c2)C1 |
| InChI | InChI=1S/C18H22N4O3/c1-21-17(23)10-14(11-19-21)22-9-5-6-13(12-22)18(24)20-15-7-3-4-8-16(15)25-2/h3-4,7-8,10-11,13H,5-6,9,12H2,1-2H3,(H,20,24)/t13-/m0/s1 |
| InChIKey | JETAAGOLGUTKSS-ZDUSSCGKSA-N |
| XLogP | 1.64 |
| TPSA | 76.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.40 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |