C21H23N5O2 — CID 71839394
N-(2-ethoxyphenyl)-1-pyrido[2,3-b]pyrazin-7-ylpiperidine-3-carboxamide (PubChem CID 71839394) has the molecular formula C21H23N5O2 and a molecular weight of 377.45 g/mol. Its IUPAC name is N-(2-ethoxyphenyl)-1-pyrido[2,3-b]pyrazin-7-ylpiperidine-3-carboxamide.
| Compound Name | N-(2-ethoxyphenyl)-1-pyrido[2,3-b]pyrazin-7-ylpiperidine-3-carboxamide |
|---|---|
| PubChem CID | 71839394 |
| Molecular Formula | C21H23N5O2 |
| Molecular Weight | 377.45 g/mol |
| Exact Mass | 377.19 |
| IUPAC Name | N-(2-ethoxyphenyl)-1-pyrido[2,3-b]pyrazin-7-ylpiperidine-3-carboxamide |
| SMILES | CCOc1ccccc1NC(=O)C1CCCN(c2cnc3nccnc3c2)C1 |
| InChI | InChI=1S/C21H23N5O2/c1-2-28-19-8-4-3-7-17(19)25-21(27)15-6-5-11-26(14-15)16-12-18-20(24-13-16)23-10-9-22-18/h3-4,7-10,12-13,15H,2,5-6,11,14H2,1H3,(H,25,27) |
| InChIKey | FPNWNAHWALBNTN-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 80.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.45 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |