C17H26N2O4S — CID 95119201
N-(2-methoxy-5-methylphenyl)-N-[(2S)-1-oxo-1-piperidin-1-ylpropan-2-yl]methanesulfonamide (PubChem CID 95119201) has the molecular formula C17H26N2O4S and a molecular weight of 354.47 g/mol. Its IUPAC name is N-(2-methoxy-5-methylphenyl)-N-[(2S)-1-oxo-1-piperidin-1-ylpropan-2-yl]methanesulfonamide.
| Compound Name | N-(2-methoxy-5-methylphenyl)-N-[(2S)-1-oxo-1-piperidin-1-ylpropan-2-yl]methanesulfonamide |
|---|---|
| PubChem CID | 95119201 |
| Molecular Formula | C17H26N2O4S |
| Molecular Weight | 354.47 g/mol |
| Exact Mass | 354.16 |
| IUPAC Name | N-(2-methoxy-5-methylphenyl)-N-[(2S)-1-oxo-1-piperidin-1-ylpropan-2-yl]methanesulfonamide |
| SMILES | COc1ccc(C)cc1N([C@@H](C)C(=O)N1CCCCC1)S(C)(=O)=O |
| InChI | InChI=1S/C17H26N2O4S/c1-13-8-9-16(23-3)15(12-13)19(24(4,21)22)14(2)17(20)18-10-6-5-7-11-18/h8-9,12,14H,5-7,10-11H2,1-4H3/t14-/m0/s1 |
| InChIKey | WJIGDWUQJSHLSY-AWEZNQCLSA-N |
| XLogP | 2.17 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.47 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |