C19H24N4O3 — CID 95119735
N-[(4R)-6-methoxy-2,2-dimethyl-3,4-dihydrochromen-4-yl]-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrazine-2-carboxamide (PubChem CID 95119735) has the molecular formula C19H24N4O3 and a molecular weight of 356.43 g/mol. Its IUPAC name is N-[(4R)-6-methoxy-2,2-dimethyl-3,4-dihydrochromen-4-yl]-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrazine-2-carboxamide.
| Compound Name | N-[(4R)-6-methoxy-2,2-dimethyl-3,4-dihydrochromen-4-yl]-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 95119735 |
| Molecular Formula | C19H24N4O3 |
| Molecular Weight | 356.43 g/mol |
| Exact Mass | 356.18 |
| IUPAC Name | N-[(4R)-6-methoxy-2,2-dimethyl-3,4-dihydrochromen-4-yl]-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrazine-2-carboxamide |
| SMILES | COc1ccc2c(c1)[C@H](NC(=O)c1cc3n(n1)CCNC3)CC(C)(C)O2 |
| InChI | InChI=1S/C19H24N4O3/c1-19(2)10-16(14-9-13(25-3)4-5-17(14)26-19)21-18(24)15-8-12-11-20-6-7-23(12)22-15/h4-5,8-9,16,20H,6-7,10-11H2,1-3H3,(H,21,24)/t16-/m1/s1 |
| InChIKey | KDTKDHAOPYXFKA-MRXNPFEDSA-N |
| XLogP | 2.03 |
| TPSA | 77.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.43 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |