C18H24N4O — CID 95121509
N-[4-[(2S)-butan-2-yl]phenyl]-2-[(5-methylpyrazin-2-yl)methylamino]acetamide (PubChem CID 95121509) has the molecular formula C18H24N4O and a molecular weight of 312.42 g/mol. Its IUPAC name is N-[4-[(2S)-butan-2-yl]phenyl]-2-[(5-methylpyrazin-2-yl)methylamino]acetamide.
| Compound Name | N-[4-[(2S)-butan-2-yl]phenyl]-2-[(5-methylpyrazin-2-yl)methylamino]acetamide |
|---|---|
| PubChem CID | 95121509 |
| Molecular Formula | C18H24N4O |
| Molecular Weight | 312.42 g/mol |
| Exact Mass | 312.20 |
| IUPAC Name | N-[4-[(2S)-butan-2-yl]phenyl]-2-[(5-methylpyrazin-2-yl)methylamino]acetamide |
| SMILES | CC[C@H](C)c1ccc(NC(=O)CNCc2cnc(C)cn2)cc1 |
| InChI | InChI=1S/C18H24N4O/c1-4-13(2)15-5-7-16(8-6-15)22-18(23)12-19-10-17-11-20-14(3)9-21-17/h5-9,11,13,19H,4,10,12H2,1-3H3,(H,22,23)/t13-/m0/s1 |
| InChIKey | NEVXUNNKHAORCC-ZDUSSCGKSA-N |
| XLogP | 3.03 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.42 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |