C22H21FN2O3 — CID 95121941
(3R)-3-(4-fluorophenyl)-4-[3-(3-hydroxy-3-methylbut-1-ynyl)benzoyl]piperazin-2-one (PubChem CID 95121941) has the molecular formula C22H21FN2O3 and a molecular weight of 380.42 g/mol. Its IUPAC name is (3R)-3-(4-fluorophenyl)-4-[3-(3-hydroxy-3-methylbut-1-ynyl)benzoyl]piperazin-2-one.
| Compound Name | (3R)-3-(4-fluorophenyl)-4-[3-(3-hydroxy-3-methylbut-1-ynyl)benzoyl]piperazin-2-one |
|---|---|
| PubChem CID | 95121941 |
| Molecular Formula | C22H21FN2O3 |
| Molecular Weight | 380.42 g/mol |
| Exact Mass | 380.15 |
| IUPAC Name | (3R)-3-(4-fluorophenyl)-4-[3-(3-hydroxy-3-methylbut-1-ynyl)benzoyl]piperazin-2-one |
| SMILES | CC(C)(O)C#Cc1cccc(C(=O)N2CCNC(=O)[C@H]2c2ccc(F)cc2)c1 |
| InChI | InChI=1S/C22H21FN2O3/c1-22(2,28)11-10-15-4-3-5-17(14-15)21(27)25-13-12-24-20(26)19(25)16-6-8-18(23)9-7-16/h3-9,14,19,28H,12-13H2,1-2H3,(H,24,26)/t19-/m1/s1 |
| InChIKey | GNNKYUKUPYCMJY-LJQANCHMSA-N |
| XLogP | 2.26 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.42 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|