C19H19NO6 — CID 95122054
methyl 2-[2-[(4S)-6-hydroxy-7-methoxy-2-oxo-3,4-dihydro-1H-quinolin-4-yl]phenoxy]acetate (PubChem CID 95122054) has the molecular formula C19H19NO6 and a molecular weight of 357.36 g/mol. Its IUPAC name is methyl 2-[2-[(4S)-6-hydroxy-7-methoxy-2-oxo-3,4-dihydro-1H-quinolin-4-yl]phenoxy]acetate.
| Compound Name | methyl 2-[2-[(4S)-6-hydroxy-7-methoxy-2-oxo-3,4-dihydro-1H-quinolin-4-yl]phenoxy]acetate |
|---|---|
| PubChem CID | 95122054 |
| Molecular Formula | C19H19NO6 |
| Molecular Weight | 357.36 g/mol |
| Exact Mass | 357.12 |
| IUPAC Name | methyl 2-[2-[(4S)-6-hydroxy-7-methoxy-2-oxo-3,4-dihydro-1H-quinolin-4-yl]phenoxy]acetate |
| SMILES | COC(=O)COc1ccccc1[C@H]1CC(=O)Nc2cc(OC)c(O)cc21 |
| InChI | InChI=1S/C19H19NO6/c1-24-17-9-14-13(7-15(17)21)12(8-18(22)20-14)11-5-3-4-6-16(11)26-10-19(23)25-2/h3-7,9,12,21H,8,10H2,1-2H3,(H,20,22)/t12-/m1/s1 |
| InChIKey | JMTFIILIZPHNRY-GFCCVEGCSA-N |
| XLogP | 2.43 |
| TPSA | 94.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.36 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|