C24H30N4O — CID 95122747
(2S)-N-ethyl-N-[(1-ethylpyrazol-4-yl)methyl]-2-(4-methylanilino)-2-phenylpropanamide (PubChem CID 95122747) has the molecular formula C24H30N4O and a molecular weight of 390.53 g/mol. Its IUPAC name is (2S)-N-ethyl-N-[(1-ethylpyrazol-4-yl)methyl]-2-(4-methylanilino)-2-phenylpropanamide.
| Compound Name | (2S)-N-ethyl-N-[(1-ethylpyrazol-4-yl)methyl]-2-(4-methylanilino)-2-phenylpropanamide |
|---|---|
| PubChem CID | 95122747 |
| Molecular Formula | C24H30N4O |
| Molecular Weight | 390.53 g/mol |
| Exact Mass | 390.24 |
| IUPAC Name | (2S)-N-ethyl-N-[(1-ethylpyrazol-4-yl)methyl]-2-(4-methylanilino)-2-phenylpropanamide |
| SMILES | CCN(Cc1cnn(CC)c1)C(=O)[C@@](C)(Nc1ccc(C)cc1)c1ccccc1 |
| InChI | InChI=1S/C24H30N4O/c1-5-27(17-20-16-25-28(6-2)18-20)23(29)24(4,21-10-8-7-9-11-21)26-22-14-12-19(3)13-15-22/h7-16,18,26H,5-6,17H2,1-4H3/t24-/m0/s1 |
| InChIKey | JHZGMUZCWUPLSX-DEOSSOPVSA-N |
| XLogP | 4.59 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.53 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |