C17H20ClN3O2S — CID 95122907
5-acetamido-2-chloro-N-[(2S)-2-(dimethylamino)-2-thiophen-2-ylethyl]benzamide (PubChem CID 95122907) has the molecular formula C17H20ClN3O2S and a molecular weight of 365.89 g/mol. Its IUPAC name is 5-acetamido-2-chloro-N-[(2S)-2-(dimethylamino)-2-thiophen-2-ylethyl]benzamide.
| Compound Name | 5-acetamido-2-chloro-N-[(2S)-2-(dimethylamino)-2-thiophen-2-ylethyl]benzamide |
|---|---|
| PubChem CID | 95122907 |
| Molecular Formula | C17H20ClN3O2S |
| Molecular Weight | 365.89 g/mol |
| Exact Mass | 365.10 |
| IUPAC Name | 5-acetamido-2-chloro-N-[(2S)-2-(dimethylamino)-2-thiophen-2-ylethyl]benzamide |
| SMILES | CC(=O)Nc1ccc(Cl)c(C(=O)NC[C@@H](c2cccs2)N(C)C)c1 |
| InChI | InChI=1S/C17H20ClN3O2S/c1-11(22)20-12-6-7-14(18)13(9-12)17(23)19-10-15(21(2)3)16-5-4-8-24-16/h4-9,15H,10H2,1-3H3,(H,19,23)(H,20,22)/t15-/m0/s1 |
| InChIKey | VLSHRZHZLLKBNZ-HNNXBMFYSA-N |
| XLogP | 3.39 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.89 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |