C15H16BrClN2OS — CID 103841422
3-bromo-4-chloro-N-[2-(dimethylamino)-2-thiophen-2-ylethyl]benzamide (PubChem CID 103841422) has the molecular formula C15H16BrClN2OS and a molecular weight of 387.73 g/mol. Its IUPAC name is 3-bromo-4-chloro-N-[2-(dimethylamino)-2-thiophen-2-ylethyl]benzamide.
| Compound Name | 3-bromo-4-chloro-N-[2-(dimethylamino)-2-thiophen-2-ylethyl]benzamide |
|---|---|
| PubChem CID | 103841422 |
| Molecular Formula | C15H16BrClN2OS |
| Molecular Weight | 387.73 g/mol |
| Exact Mass | 385.99 |
| IUPAC Name | 3-bromo-4-chloro-N-[2-(dimethylamino)-2-thiophen-2-ylethyl]benzamide |
| SMILES | CN(C)C(CNC(=O)c1ccc(Cl)c(Br)c1)c1cccs1 |
| InChI | InChI=1S/C15H16BrClN2OS/c1-19(2)13(14-4-3-7-21-14)9-18-15(20)10-5-6-12(17)11(16)8-10/h3-8,13H,9H2,1-2H3,(H,18,20) |
| InChIKey | ISEYADQHSVMQAF-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.73 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |