C16H24BrClN2O — CID 107999470
3-bromo-4-chloro-N-[2-(dimethylamino)-3-ethylpentyl]benzamide (PubChem CID 107999470) has the molecular formula C16H24BrClN2O and a molecular weight of 375.74 g/mol. Its IUPAC name is 3-bromo-4-chloro-N-[2-(dimethylamino)-3-ethylpentyl]benzamide.
| Compound Name | 3-bromo-4-chloro-N-[2-(dimethylamino)-3-ethylpentyl]benzamide |
|---|---|
| PubChem CID | 107999470 |
| Molecular Formula | C16H24BrClN2O |
| Molecular Weight | 375.74 g/mol |
| Exact Mass | 374.08 |
| IUPAC Name | 3-bromo-4-chloro-N-[2-(dimethylamino)-3-ethylpentyl]benzamide |
| SMILES | CCC(CC)C(CNC(=O)c1ccc(Cl)c(Br)c1)N(C)C |
| InChI | InChI=1S/C16H24BrClN2O/c1-5-11(6-2)15(20(3)4)10-19-16(21)12-7-8-14(18)13(17)9-12/h7-9,11,15H,5-6,10H2,1-4H3,(H,19,21) |
| InChIKey | ZZNODOWGLOXAMS-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.74 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |