C16H18F2N2OS2 — CID 18161921
4-(difluoromethylsulfanyl)-N-[2-(dimethylamino)-2-thiophen-2-ylethyl]benzamide (PubChem CID 18161921) has the molecular formula C16H18F2N2OS2 and a molecular weight of 356.46 g/mol. Its IUPAC name is 4-(difluoromethylsulfanyl)-N-[2-(dimethylamino)-2-thiophen-2-ylethyl]benzamide.
| Compound Name | 4-(difluoromethylsulfanyl)-N-[2-(dimethylamino)-2-thiophen-2-ylethyl]benzamide |
|---|---|
| PubChem CID | 18161921 |
| Molecular Formula | C16H18F2N2OS2 |
| Molecular Weight | 356.46 g/mol |
| Exact Mass | 356.08 |
| IUPAC Name | 4-(difluoromethylsulfanyl)-N-[2-(dimethylamino)-2-thiophen-2-ylethyl]benzamide |
| SMILES | CN(C)C(CNC(=O)c1ccc(SC(F)F)cc1)c1cccs1 |
| InChI | InChI=1S/C16H18F2N2OS2/c1-20(2)13(14-4-3-9-22-14)10-19-15(21)11-5-7-12(8-6-11)23-16(17)18/h3-9,13,16H,10H2,1-2H3,(H,19,21) |
| InChIKey | YUYGFNHOXFBJMN-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.46 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |