C20H27N3O3S — CID 17467084
tert-butyl N-[4-[[2-(dimethylamino)-2-thiophen-2-ylethyl]carbamoyl]phenyl]carbamate (PubChem CID 17467084) has the molecular formula C20H27N3O3S and a molecular weight of 389.52 g/mol. Its IUPAC name is tert-butyl N-[4-[[2-(dimethylamino)-2-thiophen-2-ylethyl]carbamoyl]phenyl]carbamate.
| Compound Name | tert-butyl N-[4-[[2-(dimethylamino)-2-thiophen-2-ylethyl]carbamoyl]phenyl]carbamate |
|---|---|
| PubChem CID | 17467084 |
| Molecular Formula | C20H27N3O3S |
| Molecular Weight | 389.52 g/mol |
| Exact Mass | 389.18 |
| IUPAC Name | tert-butyl N-[4-[[2-(dimethylamino)-2-thiophen-2-ylethyl]carbamoyl]phenyl]carbamate |
| SMILES | CN(C)C(CNC(=O)c1ccc(NC(=O)OC(C)(C)C)cc1)c1cccs1 |
| InChI | InChI=1S/C20H27N3O3S/c1-20(2,3)26-19(25)22-15-10-8-14(9-11-15)18(24)21-13-16(23(4)5)17-7-6-12-27-17/h6-12,16H,13H2,1-5H3,(H,21,24)(H,22,25) |
| InChIKey | JHKQZCGKVOCKSF-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.52 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |