C16H26N2O2S — CID 95123004
(2R)-N-(2-hydroxyethyl)-1-methyl-N-[(3-methylthiophen-2-yl)methyl]azepane-2-carboxamide (PubChem CID 95123004) has the molecular formula C16H26N2O2S and a molecular weight of 310.46 g/mol. Its IUPAC name is (2R)-N-(2-hydroxyethyl)-1-methyl-N-[(3-methylthiophen-2-yl)methyl]azepane-2-carboxamide.
| Compound Name | (2R)-N-(2-hydroxyethyl)-1-methyl-N-[(3-methylthiophen-2-yl)methyl]azepane-2-carboxamide |
|---|---|
| PubChem CID | 95123004 |
| Molecular Formula | C16H26N2O2S |
| Molecular Weight | 310.46 g/mol |
| Exact Mass | 310.17 |
| IUPAC Name | (2R)-N-(2-hydroxyethyl)-1-methyl-N-[(3-methylthiophen-2-yl)methyl]azepane-2-carboxamide |
| SMILES | Cc1ccsc1CN(CCO)C(=O)[C@H]1CCCCCN1C |
| InChI | InChI=1S/C16H26N2O2S/c1-13-7-11-21-15(13)12-18(9-10-19)16(20)14-6-4-3-5-8-17(14)2/h7,11,14,19H,3-6,8-10,12H2,1-2H3/t14-/m1/s1 |
| InChIKey | VLJLZCYLXGDBNB-CQSZACIVSA-N |
| XLogP | 2.25 |
| TPSA | 43.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.46 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |