C14H25N3O4 — CID 95124713
methyl 2-methyl-2-[[2-[(2S)-3-oxo-1-propan-2-ylpiperazin-2-yl]acetyl]amino]propanoate (PubChem CID 95124713) has the molecular formula C14H25N3O4 and a molecular weight of 299.37 g/mol. Its IUPAC name is methyl 2-methyl-2-[[2-[(2S)-3-oxo-1-propan-2-ylpiperazin-2-yl]acetyl]amino]propanoate.
| Compound Name | methyl 2-methyl-2-[[2-[(2S)-3-oxo-1-propan-2-ylpiperazin-2-yl]acetyl]amino]propanoate |
|---|---|
| PubChem CID | 95124713 |
| Molecular Formula | C14H25N3O4 |
| Molecular Weight | 299.37 g/mol |
| Exact Mass | 299.18 |
| IUPAC Name | methyl 2-methyl-2-[[2-[(2S)-3-oxo-1-propan-2-ylpiperazin-2-yl]acetyl]amino]propanoate |
| SMILES | COC(=O)C(C)(C)NC(=O)C[C@H]1C(=O)NCCN1C(C)C |
| InChI | InChI=1S/C14H25N3O4/c1-9(2)17-7-6-15-12(19)10(17)8-11(18)16-14(3,4)13(20)21-5/h9-10H,6-8H2,1-5H3,(H,15,19)(H,16,18)/t10-/m0/s1 |
| InChIKey | ZKYFWDSSENSBAZ-JTQLQIEISA-N |
| XLogP | -0.35 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.37 |
| LogP ≤ 5 | -0.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |