C22H32N4O2 — CID 95552184
N-[(2-ethyl-3,5-dimethyl-1H-indol-7-yl)methyl]-2-[(2S)-3-oxo-1-propan-2-ylpiperazin-2-yl]acetamide (PubChem CID 95552184) has the molecular formula C22H32N4O2 and a molecular weight of 384.52 g/mol. Its IUPAC name is N-[(2-ethyl-3,5-dimethyl-1H-indol-7-yl)methyl]-2-[(2S)-3-oxo-1-propan-2-ylpiperazin-2-yl]acetamide.
| Compound Name | N-[(2-ethyl-3,5-dimethyl-1H-indol-7-yl)methyl]-2-[(2S)-3-oxo-1-propan-2-ylpiperazin-2-yl]acetamide |
|---|---|
| PubChem CID | 95552184 |
| Molecular Formula | C22H32N4O2 |
| Molecular Weight | 384.52 g/mol |
| Exact Mass | 384.25 |
| IUPAC Name | N-[(2-ethyl-3,5-dimethyl-1H-indol-7-yl)methyl]-2-[(2S)-3-oxo-1-propan-2-ylpiperazin-2-yl]acetamide |
| SMILES | CCc1[nH]c2c(CNC(=O)C[C@H]3C(=O)NCCN3C(C)C)cc(C)cc2c1C |
| InChI | InChI=1S/C22H32N4O2/c1-6-18-15(5)17-10-14(4)9-16(21(17)25-18)12-24-20(27)11-19-22(28)23-7-8-26(19)13(2)3/h9-10,13,19,25H,6-8,11-12H2,1-5H3,(H,23,28)(H,24,27)/t19-/m0/s1 |
| InChIKey | QRWRPGCRQOCGCB-IBGZPJMESA-N |
| XLogP | 2.56 |
| TPSA | 77.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.52 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|