C21H26N4O — CID 56878713
N-[(2-ethyl-3,5-dimethyl-1H-indol-7-yl)methyl]-1-(pyrazol-1-ylmethyl)cyclopropane-1-carboxamide (PubChem CID 56878713) has the molecular formula C21H26N4O and a molecular weight of 350.47 g/mol. Its IUPAC name is N-[(2-ethyl-3,5-dimethyl-1H-indol-7-yl)methyl]-1-(pyrazol-1-ylmethyl)cyclopropane-1-carboxamide.
| Compound Name | N-[(2-ethyl-3,5-dimethyl-1H-indol-7-yl)methyl]-1-(pyrazol-1-ylmethyl)cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 56878713 |
| Molecular Formula | C21H26N4O |
| Molecular Weight | 350.47 g/mol |
| Exact Mass | 350.21 |
| IUPAC Name | N-[(2-ethyl-3,5-dimethyl-1H-indol-7-yl)methyl]-1-(pyrazol-1-ylmethyl)cyclopropane-1-carboxamide |
| SMILES | CCc1[nH]c2c(CNC(=O)C3(Cn4cccn4)CC3)cc(C)cc2c1C |
| InChI | InChI=1S/C21H26N4O/c1-4-18-15(3)17-11-14(2)10-16(19(17)24-18)12-22-20(26)21(6-7-21)13-25-9-5-8-23-25/h5,8-11,24H,4,6-7,12-13H2,1-3H3,(H,22,26) |
| InChIKey | NOXPHNTWYCEINF-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 62.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.47 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|