About (2S)-N-[(2-ethyl-3,5-dimethyl-1H-indol-7-yl)methyl]-2-imidazol-1-ylpropanamide
(2S)-N-[(2-ethyl-3,5-dimethyl-1H-indol-7-yl)methyl]-2-imidazol-1-ylpropanamide (PubChem CID 95445277) has the molecular formula C19H24N4O
and a molecular weight of 324.43 g/mol. Its IUPAC name is (2S)-N-[(2-ethyl-3,5-dimethyl-1H-indol-7-yl)methyl]-2-imidazol-1-ylpropanamide.
Molecular Properties
| Compound Name | (2S)-N-[(2-ethyl-3,5-dimethyl-1H-indol-7-yl)methyl]-2-imidazol-1-ylpropanamide |
| PubChem CID | 95445277 |
| Molecular Formula | C19H24N4O |
| Molecular Weight | 324.43 g/mol |
| Exact Mass | 324.20 |
| IUPAC Name | (2S)-N-[(2-ethyl-3,5-dimethyl-1H-indol-7-yl)methyl]-2-imidazol-1-ylpropanamide |
| SMILES | CCc1[nH]c2c(CNC(=O)[C@H](C)n3ccnc3)cc(C)cc2c1C |
| InChI | InChI=1S/C19H24N4O/c1-5-17-13(3)16-9-12(2)8-15(18(16)22-17)10-21-19(24)14(4)23-7-6-20-11-23/h6-9,11,14,22H,5,10H2,1-4H3,(H,21,24)/t14-/m0/s1 |
| InChIKey | AYNNWJRGMVNUFZ-AWEZNQCLSA-N |
| XLogP | 3.42 |
| TPSA | 62.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 324.43 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|
Analyze (2S)-N-[(2-ethyl-3,5-dimethyl-1H-indol-7-yl)methyl]-2-imidazol-1-ylpropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-N-[(2-ethyl-3,5-dimethyl-1H-indol-7-yl)methyl]-2-imidazol-1-ylpropanamide?
The IUPAC name of (2S)-N-[(2-ethyl-3,5-dimethyl-1H-indol-7-yl)methyl]-2-imidazol-1-ylpropanamide (CID 95445277) is (2S)-N-[(2-ethyl-3,5-dimethyl-1H-indol-7-yl)methyl]-2-imidazol-1-ylpropanamide.
What is the SMILES notation for (2S)-N-[(2-ethyl-3,5-dimethyl-1H-indol-7-yl)methyl]-2-imidazol-1-ylpropanamide?
The canonical SMILES for (2S)-N-[(2-ethyl-3,5-dimethyl-1H-indol-7-yl)methyl]-2-imidazol-1-ylpropanamide is CCc1[nH]c2c(CNC(=O)[C@H](C)n3ccnc3)cc(C)cc2c1C.
What is the InChIKey of (2S)-N-[(2-ethyl-3,5-dimethyl-1H-indol-7-yl)methyl]-2-imidazol-1-ylpropanamide?
The InChIKey is AYNNWJRGMVNUFZ-AWEZNQCLSA-N. The full InChI is InChI=1S/C19H24N4O/c1-5-17-13(3)16-9-12(2)8-15(18(16)22-17)10-21-19(24)14(4)23-7-6-20-11-23/h6-9,11,14,22H,5,10H2,1-4H3,(H,21,24)/t14-/m0/s1.
What are the key properties of (2S)-N-[(2-ethyl-3,5-dimethyl-1H-indol-7-yl)methyl]-2-imidazol-1-ylpropanamide?
(2S)-N-[(2-ethyl-3,5-dimethyl-1H-indol-7-yl)methyl]-2-imidazol-1-ylpropanamide has a molecular weight of 324.43 g/mol, XLogP of 3.42, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-N-[(2-ethyl-3,5-dimethyl-1H-indol-7-yl)methyl]-2-imidazol-1-ylpropanamide is sourced from PubChem (CID 95445277), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).