C22H27N5O2 — CID 56861740
[6-[(2-ethyl-3,5-dimethyl-1H-indol-7-yl)methylamino]pyrazin-2-yl]-morpholin-4-ylmethanone (PubChem CID 56861740) has the molecular formula C22H27N5O2 and a molecular weight of 393.49 g/mol. Its IUPAC name is [6-[(2-ethyl-3,5-dimethyl-1H-indol-7-yl)methylamino]pyrazin-2-yl]-morpholin-4-ylmethanone.
| Compound Name | [6-[(2-ethyl-3,5-dimethyl-1H-indol-7-yl)methylamino]pyrazin-2-yl]-morpholin-4-ylmethanone |
|---|---|
| PubChem CID | 56861740 |
| Molecular Formula | C22H27N5O2 |
| Molecular Weight | 393.49 g/mol |
| Exact Mass | 393.22 |
| IUPAC Name | [6-[(2-ethyl-3,5-dimethyl-1H-indol-7-yl)methylamino]pyrazin-2-yl]-morpholin-4-ylmethanone |
| SMILES | CCc1[nH]c2c(CNc3cncc(C(=O)N4CCOCC4)n3)cc(C)cc2c1C |
| InChI | InChI=1S/C22H27N5O2/c1-4-18-15(3)17-10-14(2)9-16(21(17)26-18)11-24-20-13-23-12-19(25-20)22(28)27-5-7-29-8-6-27/h9-10,12-13,26H,4-8,11H2,1-3H3,(H,24,25) |
| InChIKey | BEWCCENQJWLZJD-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 83.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.49 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|