About [6-[(2-ethyl-3,5-dimethyl-1H-indol-7-yl)methylamino]pyrazin-2-yl]-morpholin-4-ylmethanone
[6-[(2-ethyl-3,5-dimethyl-1H-indol-7-yl)methylamino]pyrazin-2-yl]-morpholin-4-ylmethanone (PubChem CID 56861740) has the molecular formula C22H27N5O2
and a molecular weight of 393.49 g/mol. Its IUPAC name is [6-[(2-ethyl-3,5-dimethyl-1H-indol-7-yl)methylamino]pyrazin-2-yl]-morpholin-4-ylmethanone.
Molecular Properties
| Compound Name | [6-[(2-ethyl-3,5-dimethyl-1H-indol-7-yl)methylamino]pyrazin-2-yl]-morpholin-4-ylmethanone |
| PubChem CID | 56861740 |
| Molecular Formula | C22H27N5O2 |
| Molecular Weight | 393.49 g/mol |
| Exact Mass | 393.22 |
| IUPAC Name | [6-[(2-ethyl-3,5-dimethyl-1H-indol-7-yl)methylamino]pyrazin-2-yl]-morpholin-4-ylmethanone |
| SMILES | CCc1[nH]c2c(CNc3cncc(C(=O)N4CCOCC4)n3)cc(C)cc2c1C |
| InChI | InChI=1S/C22H27N5O2/c1-4-18-15(3)17-10-14(2)9-16(21(17)26-18)11-24-20-13-23-12-19(25-20)22(28)27-5-7-29-8-6-27/h9-10,12-13,26H,4-8,11H2,1-3H3,(H,24,25) |
| InChIKey | BEWCCENQJWLZJD-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 83.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 393.49 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|
Analyze [6-[(2-ethyl-3,5-dimethyl-1H-indol-7-yl)methylamino]pyrazin-2-yl]-morpholin-4-ylmethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [6-[(2-ethyl-3,5-dimethyl-1H-indol-7-yl)methylamino]pyrazin-2-yl]-morpholin-4-ylmethanone?
The IUPAC name of [6-[(2-ethyl-3,5-dimethyl-1H-indol-7-yl)methylamino]pyrazin-2-yl]-morpholin-4-ylmethanone (CID 56861740) is [6-[(2-ethyl-3,5-dimethyl-1H-indol-7-yl)methylamino]pyrazin-2-yl]-morpholin-4-ylmethanone.
What is the SMILES notation for [6-[(2-ethyl-3,5-dimethyl-1H-indol-7-yl)methylamino]pyrazin-2-yl]-morpholin-4-ylmethanone?
The canonical SMILES for [6-[(2-ethyl-3,5-dimethyl-1H-indol-7-yl)methylamino]pyrazin-2-yl]-morpholin-4-ylmethanone is CCc1[nH]c2c(CNc3cncc(C(=O)N4CCOCC4)n3)cc(C)cc2c1C.
What is the InChIKey of [6-[(2-ethyl-3,5-dimethyl-1H-indol-7-yl)methylamino]pyrazin-2-yl]-morpholin-4-ylmethanone?
The InChIKey is BEWCCENQJWLZJD-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H27N5O2/c1-4-18-15(3)17-10-14(2)9-16(21(17)26-18)11-24-20-13-23-12-19(25-20)22(28)27-5-7-29-8-6-27/h9-10,12-13,26H,4-8,11H2,1-3H3,(H,24,25).
What are the key properties of [6-[(2-ethyl-3,5-dimethyl-1H-indol-7-yl)methylamino]pyrazin-2-yl]-morpholin-4-ylmethanone?
[6-[(2-ethyl-3,5-dimethyl-1H-indol-7-yl)methylamino]pyrazin-2-yl]-morpholin-4-ylmethanone has a molecular weight of 393.49 g/mol, XLogP of 3.22, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [6-[(2-ethyl-3,5-dimethyl-1H-indol-7-yl)methylamino]pyrazin-2-yl]-morpholin-4-ylmethanone is sourced from PubChem (CID 56861740), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).