C21H26FN5O — CID 56874493
N-[(2-ethyl-3,5-dimethyl-1H-indol-7-yl)methyl]-5-fluoro-4-morpholin-4-ylpyrimidin-2-amine (PubChem CID 56874493) has the molecular formula C21H26FN5O and a molecular weight of 383.47 g/mol. Its IUPAC name is N-[(2-ethyl-3,5-dimethyl-1H-indol-7-yl)methyl]-5-fluoro-4-morpholin-4-ylpyrimidin-2-amine.
| Compound Name | N-[(2-ethyl-3,5-dimethyl-1H-indol-7-yl)methyl]-5-fluoro-4-morpholin-4-ylpyrimidin-2-amine |
|---|---|
| PubChem CID | 56874493 |
| Molecular Formula | C21H26FN5O |
| Molecular Weight | 383.47 g/mol |
| Exact Mass | 383.21 |
| IUPAC Name | N-[(2-ethyl-3,5-dimethyl-1H-indol-7-yl)methyl]-5-fluoro-4-morpholin-4-ylpyrimidin-2-amine |
| SMILES | CCc1[nH]c2c(CNc3ncc(F)c(N4CCOCC4)n3)cc(C)cc2c1C |
| InChI | InChI=1S/C21H26FN5O/c1-4-18-14(3)16-10-13(2)9-15(19(16)25-18)11-23-21-24-12-17(22)20(26-21)27-5-7-28-8-6-27/h9-10,12,25H,4-8,11H2,1-3H3,(H,23,24,26) |
| InChIKey | DUXGNJZYTLBPNL-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 66.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.47 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|