C9H12FN5O2 — CID 143431084
N-[(5-fluoro-4-morpholin-4-ylpyrimidin-2-yl)amino]formamide (PubChem CID 143431084) has the molecular formula C9H12FN5O2 and a molecular weight of 241.23 g/mol. Its IUPAC name is N-[(5-fluoro-4-morpholin-4-ylpyrimidin-2-yl)amino]formamide.
| Compound Name | N-[(5-fluoro-4-morpholin-4-ylpyrimidin-2-yl)amino]formamide |
|---|---|
| PubChem CID | 143431084 |
| Molecular Formula | C9H12FN5O2 |
| Molecular Weight | 241.23 g/mol |
| Exact Mass | 241.10 |
| IUPAC Name | N-[(5-fluoro-4-morpholin-4-ylpyrimidin-2-yl)amino]formamide |
| SMILES | O=CNNc1ncc(F)c(N2CCOCC2)n1 |
| InChI | InChI=1S/C9H12FN5O2/c10-7-5-11-9(14-12-6-16)13-8(7)15-1-3-17-4-2-15/h5-6H,1-4H2,(H,12,16)(H,11,13,14) |
| InChIKey | PASAPMXURHUBAG-UHFFFAOYSA-N |
| XLogP | -0.47 |
| TPSA | 79.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.23 |
| LogP ≤ 5 | -0.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|