C9H10FIN4O2 — CID 130197461
5-fluoro-N-iodo-4-morpholin-4-ylpyrimidine-2-carboxamide (PubChem CID 130197461) has the molecular formula C9H10FIN4O2 and a molecular weight of 352.11 g/mol. Its IUPAC name is 5-fluoro-N-iodo-4-morpholin-4-ylpyrimidine-2-carboxamide.
| Compound Name | 5-fluoro-N-iodo-4-morpholin-4-ylpyrimidine-2-carboxamide |
|---|---|
| PubChem CID | 130197461 |
| Molecular Formula | C9H10FIN4O2 |
| Molecular Weight | 352.11 g/mol |
| Exact Mass | 351.98 |
| IUPAC Name | 5-fluoro-N-iodo-4-morpholin-4-ylpyrimidine-2-carboxamide |
| SMILES | O=C(NI)c1ncc(F)c(N2CCOCC2)n1 |
| InChI | InChI=1S/C9H10FIN4O2/c10-6-5-12-7(9(16)14-11)13-8(6)15-1-3-17-4-2-15/h5H,1-4H2,(H,14,16) |
| InChIKey | RNLQQUOKAGJVIO-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.11 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|