C18H28FN5O2 — CID 50965748
5-fluoro-4-morpholin-4-yl-N-[1-(oxan-4-yl)piperidin-4-yl]pyrimidin-2-amine (PubChem CID 50965748) has the molecular formula C18H28FN5O2 and a molecular weight of 365.45 g/mol. Its IUPAC name is 5-fluoro-4-morpholin-4-yl-N-[1-(oxan-4-yl)piperidin-4-yl]pyrimidin-2-amine.
| Compound Name | 5-fluoro-4-morpholin-4-yl-N-[1-(oxan-4-yl)piperidin-4-yl]pyrimidin-2-amine |
|---|---|
| PubChem CID | 50965748 |
| Molecular Formula | C18H28FN5O2 |
| Molecular Weight | 365.45 g/mol |
| Exact Mass | 365.22 |
| IUPAC Name | 5-fluoro-4-morpholin-4-yl-N-[1-(oxan-4-yl)piperidin-4-yl]pyrimidin-2-amine |
| SMILES | Fc1cnc(NC2CCN(C3CCOCC3)CC2)nc1N1CCOCC1 |
| InChI | InChI=1S/C18H28FN5O2/c19-16-13-20-18(22-17(16)24-7-11-26-12-8-24)21-14-1-5-23(6-2-14)15-3-9-25-10-4-15/h13-15H,1-12H2,(H,20,21,22) |
| InChIKey | DZRAEQJECLWRCT-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 62.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.45 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |