About 5-fluoro-N-[(3S,4R)-4-methoxyoxolan-3-yl]-4-morpholin-4-ylpyrimidin-2-amine
5-fluoro-N-[(3S,4R)-4-methoxyoxolan-3-yl]-4-morpholin-4-ylpyrimidin-2-amine (PubChem CID 134696082) has the molecular formula C13H19FN4O3
and a molecular weight of 298.32 g/mol. Its IUPAC name is 5-fluoro-N-[(3S,4R)-4-methoxyoxolan-3-yl]-4-morpholin-4-ylpyrimidin-2-amine.
Molecular Properties
| Compound Name | 5-fluoro-N-[(3S,4R)-4-methoxyoxolan-3-yl]-4-morpholin-4-ylpyrimidin-2-amine |
| PubChem CID | 134696082 |
| Molecular Formula | C13H19FN4O3 |
| Molecular Weight | 298.32 g/mol |
| Exact Mass | 298.14 |
| IUPAC Name | 5-fluoro-N-[(3S,4R)-4-methoxyoxolan-3-yl]-4-morpholin-4-ylpyrimidin-2-amine |
| SMILES | CO[C@H]1COC[C@@H]1Nc1ncc(F)c(N2CCOCC2)n1 |
| InChI | InChI=1S/C13H19FN4O3/c1-19-11-8-21-7-10(11)16-13-15-6-9(14)12(17-13)18-2-4-20-5-3-18/h6,10-11H,2-5,7-8H2,1H3,(H,15,16,17)/t10-,11-/m0/s1 |
| InChIKey | HLLGDUNVAPPPFA-QWRGUYRKSA-N |
| XLogP | 0.28 |
| TPSA | 68.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 298.32 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 5-fluoro-N-[(3S,4R)-4-methoxyoxolan-3-yl]-4-morpholin-4-ylpyrimidin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-fluoro-N-[(3S,4R)-4-methoxyoxolan-3-yl]-4-morpholin-4-ylpyrimidin-2-amine?
The IUPAC name of 5-fluoro-N-[(3S,4R)-4-methoxyoxolan-3-yl]-4-morpholin-4-ylpyrimidin-2-amine (CID 134696082) is 5-fluoro-N-[(3S,4R)-4-methoxyoxolan-3-yl]-4-morpholin-4-ylpyrimidin-2-amine.
What is the SMILES notation for 5-fluoro-N-[(3S,4R)-4-methoxyoxolan-3-yl]-4-morpholin-4-ylpyrimidin-2-amine?
The canonical SMILES for 5-fluoro-N-[(3S,4R)-4-methoxyoxolan-3-yl]-4-morpholin-4-ylpyrimidin-2-amine is CO[C@H]1COC[C@@H]1Nc1ncc(F)c(N2CCOCC2)n1.
What is the InChIKey of 5-fluoro-N-[(3S,4R)-4-methoxyoxolan-3-yl]-4-morpholin-4-ylpyrimidin-2-amine?
The InChIKey is HLLGDUNVAPPPFA-QWRGUYRKSA-N. The full InChI is InChI=1S/C13H19FN4O3/c1-19-11-8-21-7-10(11)16-13-15-6-9(14)12(17-13)18-2-4-20-5-3-18/h6,10-11H,2-5,7-8H2,1H3,(H,15,16,17)/t10-,11-/m0/s1.
What are the key properties of 5-fluoro-N-[(3S,4R)-4-methoxyoxolan-3-yl]-4-morpholin-4-ylpyrimidin-2-amine?
5-fluoro-N-[(3S,4R)-4-methoxyoxolan-3-yl]-4-morpholin-4-ylpyrimidin-2-amine has a molecular weight of 298.32 g/mol, XLogP of 0.28, 4 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 5-fluoro-N-[(3S,4R)-4-methoxyoxolan-3-yl]-4-morpholin-4-ylpyrimidin-2-amine is sourced from PubChem (CID 134696082), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).