C9H12FIN4O2 — CID 134254858
(5-fluoro-4-morpholin-4-ylpyrimidin-2-yl)-(iodoamino)methanol (PubChem CID 134254858) has the molecular formula C9H12FIN4O2 and a molecular weight of 354.12 g/mol. Its IUPAC name is (5-fluoro-4-morpholin-4-ylpyrimidin-2-yl)-(iodoamino)methanol.
| Compound Name | (5-fluoro-4-morpholin-4-ylpyrimidin-2-yl)-(iodoamino)methanol |
|---|---|
| PubChem CID | 134254858 |
| Molecular Formula | C9H12FIN4O2 |
| Molecular Weight | 354.12 g/mol |
| Exact Mass | 354.00 |
| IUPAC Name | (5-fluoro-4-morpholin-4-ylpyrimidin-2-yl)-(iodoamino)methanol |
| SMILES | OC(NI)c1ncc(F)c(N2CCOCC2)n1 |
| InChI | InChI=1S/C9H12FIN4O2/c10-6-5-12-7(9(16)14-11)13-8(6)15-1-3-17-4-2-15/h5,9,14,16H,1-4H2 |
| InChIKey | RCWKSIZAQSPTPE-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 70.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.12 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|