C15H15ClFN3O2 — CID 137335375
2-chloro-4-(5-fluoro-4-morpholin-4-ylpyrimidin-2-yl)-5-methylphenol (PubChem CID 137335375) has the molecular formula C15H15ClFN3O2 and a molecular weight of 323.75 g/mol. Its IUPAC name is 2-chloro-4-(5-fluoro-4-morpholin-4-ylpyrimidin-2-yl)-5-methylphenol.
| Compound Name | 2-chloro-4-(5-fluoro-4-morpholin-4-ylpyrimidin-2-yl)-5-methylphenol |
|---|---|
| PubChem CID | 137335375 |
| Molecular Formula | C15H15ClFN3O2 |
| Molecular Weight | 323.75 g/mol |
| Exact Mass | 323.08 |
| IUPAC Name | 2-chloro-4-(5-fluoro-4-morpholin-4-ylpyrimidin-2-yl)-5-methylphenol |
| SMILES | Cc1cc(O)c(Cl)cc1-c1ncc(F)c(N2CCOCC2)n1 |
| InChI | InChI=1S/C15H15ClFN3O2/c1-9-6-13(21)11(16)7-10(9)14-18-8-12(17)15(19-14)20-2-4-22-5-3-20/h6-8,21H,2-5H2,1H3 |
| InChIKey | XTFJZQQENNXQKH-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 58.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.75 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |