C17H20FN5O2 — CID 145466890
1-[2-(5-fluoro-4-morpholin-4-ylpyrimidin-2-yl)-1,3-oxazol-4-yl]-N-propylprop-2-en-1-imine (PubChem CID 145466890) has the molecular formula C17H20FN5O2 and a molecular weight of 345.38 g/mol. Its IUPAC name is 1-[2-(5-fluoro-4-morpholin-4-ylpyrimidin-2-yl)-1,3-oxazol-4-yl]-N-propylprop-2-en-1-imine.
| Compound Name | 1-[2-(5-fluoro-4-morpholin-4-ylpyrimidin-2-yl)-1,3-oxazol-4-yl]-N-propylprop-2-en-1-imine |
|---|---|
| PubChem CID | 145466890 |
| Molecular Formula | C17H20FN5O2 |
| Molecular Weight | 345.38 g/mol |
| Exact Mass | 345.16 |
| IUPAC Name | 1-[2-(5-fluoro-4-morpholin-4-ylpyrimidin-2-yl)-1,3-oxazol-4-yl]-N-propylprop-2-en-1-imine |
| SMILES | C=C/C(=N\CCC)c1coc(-c2ncc(F)c(N3CCOCC3)n2)n1 |
| InChI | InChI=1S/C17H20FN5O2/c1-3-5-19-13(4-2)14-11-25-17(21-14)15-20-10-12(18)16(22-15)23-6-8-24-9-7-23/h4,10-11H,2-3,5-9H2,1H3/b19-13+ |
| InChIKey | BYXAOCMEGKBGQL-CPNJWEJPSA-N |
| XLogP | 2.49 |
| TPSA | 76.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.38 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|