C16H20FN5O — CID 143470922
5-fluoro-4-morpholin-4-yl-N-[(E)-[(2E)-2-[(Z)-prop-1-enyl]penta-2,4-dienylidene]amino]pyrimidin-2-amine (PubChem CID 143470922) has the molecular formula C16H20FN5O and a molecular weight of 317.37 g/mol. Its IUPAC name is 5-fluoro-4-morpholin-4-yl-N-[(E)-[(2E)-2-[(Z)-prop-1-enyl]penta-2,4-dienylidene]amino]pyrimidin-2-amine.
| Compound Name | 5-fluoro-4-morpholin-4-yl-N-[(E)-[(2E)-2-[(Z)-prop-1-enyl]penta-2,4-dienylidene]amino]pyrimidin-2-amine |
|---|---|
| PubChem CID | 143470922 |
| Molecular Formula | C16H20FN5O |
| Molecular Weight | 317.37 g/mol |
| Exact Mass | 317.17 |
| IUPAC Name | 5-fluoro-4-morpholin-4-yl-N-[(E)-[(2E)-2-[(Z)-prop-1-enyl]penta-2,4-dienylidene]amino]pyrimidin-2-amine |
| SMILES | C=C/C=C(\C=C/C)/C=N/Nc1ncc(F)c(N2CCOCC2)n1 |
| InChI | InChI=1S/C16H20FN5O/c1-3-5-13(6-4-2)11-19-21-16-18-12-14(17)15(20-16)22-7-9-23-10-8-22/h3-6,11-12H,1,7-10H2,2H3,(H,18,20,21)/b6-4-,13-5+,19-11+ |
| InChIKey | BKNWARCCHAXHQF-QTXSXPSMSA-N |
| XLogP | 2.54 |
| TPSA | 62.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.37 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|