C16H17FN4 — CID 56880237
N-[(2-ethyl-5-fluoro-3-methyl-1H-indol-7-yl)methyl]pyrazin-2-amine (PubChem CID 56880237) has the molecular formula C16H17FN4 and a molecular weight of 284.34 g/mol. Its IUPAC name is N-[(2-ethyl-5-fluoro-3-methyl-1H-indol-7-yl)methyl]pyrazin-2-amine.
| Compound Name | N-[(2-ethyl-5-fluoro-3-methyl-1H-indol-7-yl)methyl]pyrazin-2-amine |
|---|---|
| PubChem CID | 56880237 |
| Molecular Formula | C16H17FN4 |
| Molecular Weight | 284.34 g/mol |
| Exact Mass | 284.14 |
| IUPAC Name | N-[(2-ethyl-5-fluoro-3-methyl-1H-indol-7-yl)methyl]pyrazin-2-amine |
| SMILES | CCc1[nH]c2c(CNc3cnccn3)cc(F)cc2c1C |
| InChI | InChI=1S/C16H17FN4/c1-3-14-10(2)13-7-12(17)6-11(16(13)21-14)8-20-15-9-18-4-5-19-15/h4-7,9,21H,3,8H2,1-2H3,(H,19,20) |
| InChIKey | YTBZHBKQAXBMPI-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.34 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|