C19H23FN4O — CID 56872669
N-[(2-ethyl-5-fluoro-3-methyl-1H-indol-7-yl)methyl]-4-(1H-pyrazol-4-yl)butanamide (PubChem CID 56872669) has the molecular formula C19H23FN4O and a molecular weight of 342.42 g/mol. Its IUPAC name is N-[(2-ethyl-5-fluoro-3-methyl-1H-indol-7-yl)methyl]-4-(1H-pyrazol-4-yl)butanamide.
| Compound Name | N-[(2-ethyl-5-fluoro-3-methyl-1H-indol-7-yl)methyl]-4-(1H-pyrazol-4-yl)butanamide |
|---|---|
| PubChem CID | 56872669 |
| Molecular Formula | C19H23FN4O |
| Molecular Weight | 342.42 g/mol |
| Exact Mass | 342.19 |
| IUPAC Name | N-[(2-ethyl-5-fluoro-3-methyl-1H-indol-7-yl)methyl]-4-(1H-pyrazol-4-yl)butanamide |
| SMILES | CCc1[nH]c2c(CNC(=O)CCCc3cn[nH]c3)cc(F)cc2c1C |
| InChI | InChI=1S/C19H23FN4O/c1-3-17-12(2)16-8-15(20)7-14(19(16)24-17)11-21-18(25)6-4-5-13-9-22-23-10-13/h7-10,24H,3-6,11H2,1-2H3,(H,21,25)(H,22,23) |
| InChIKey | FEVGWYFZJGFNPN-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 73.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.42 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|