C23H36N4O — CID 95555062
(4S)-N-[(2-ethyl-3,5-dimethyl-1H-indol-7-yl)methyl]-4-(4-methylpiperazin-1-yl)pentanamide (PubChem CID 95555062) has the molecular formula C23H36N4O and a molecular weight of 384.57 g/mol. Its IUPAC name is (4S)-N-[(2-ethyl-3,5-dimethyl-1H-indol-7-yl)methyl]-4-(4-methylpiperazin-1-yl)pentanamide.
| Compound Name | (4S)-N-[(2-ethyl-3,5-dimethyl-1H-indol-7-yl)methyl]-4-(4-methylpiperazin-1-yl)pentanamide |
|---|---|
| PubChem CID | 95555062 |
| Molecular Formula | C23H36N4O |
| Molecular Weight | 384.57 g/mol |
| Exact Mass | 384.29 |
| IUPAC Name | (4S)-N-[(2-ethyl-3,5-dimethyl-1H-indol-7-yl)methyl]-4-(4-methylpiperazin-1-yl)pentanamide |
| SMILES | CCc1[nH]c2c(CNC(=O)CC[C@H](C)N3CCN(C)CC3)cc(C)cc2c1C |
| InChI | InChI=1S/C23H36N4O/c1-6-21-18(4)20-14-16(2)13-19(23(20)25-21)15-24-22(28)8-7-17(3)27-11-9-26(5)10-12-27/h13-14,17,25H,6-12,15H2,1-5H3,(H,24,28)/t17-/m0/s1 |
| InChIKey | LSRWUHZVESYKHU-KRWDZBQOSA-N |
| XLogP | 3.38 |
| TPSA | 51.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.57 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|