C21H30FN3O2 — CID 95426875
(4S)-N-[(2-ethyl-5-fluoro-3-methyl-1H-indol-7-yl)methyl]-4-morpholin-4-ylpentanamide (PubChem CID 95426875) has the molecular formula C21H30FN3O2 and a molecular weight of 375.49 g/mol. Its IUPAC name is (4S)-N-[(2-ethyl-5-fluoro-3-methyl-1H-indol-7-yl)methyl]-4-morpholin-4-ylpentanamide.
| Compound Name | (4S)-N-[(2-ethyl-5-fluoro-3-methyl-1H-indol-7-yl)methyl]-4-morpholin-4-ylpentanamide |
|---|---|
| PubChem CID | 95426875 |
| Molecular Formula | C21H30FN3O2 |
| Molecular Weight | 375.49 g/mol |
| Exact Mass | 375.23 |
| IUPAC Name | (4S)-N-[(2-ethyl-5-fluoro-3-methyl-1H-indol-7-yl)methyl]-4-morpholin-4-ylpentanamide |
| SMILES | CCc1[nH]c2c(CNC(=O)CC[C@H](C)N3CCOCC3)cc(F)cc2c1C |
| InChI | InChI=1S/C21H30FN3O2/c1-4-19-15(3)18-12-17(22)11-16(21(18)24-19)13-23-20(26)6-5-14(2)25-7-9-27-10-8-25/h11-12,14,24H,4-10,13H2,1-3H3,(H,23,26)/t14-/m0/s1 |
| InChIKey | GLKVUZGDWPXUAS-AWEZNQCLSA-N |
| XLogP | 3.29 |
| TPSA | 57.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.49 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|